C8H16N2O6S — CID 80756409
(2R)-3-hydroxy-2-[[methyl(2-methylsulfonylethyl)carbamoyl]amino]propanoic acid (PubChem CID 80756409) has the molecular formula C8H16N2O6S and a molecular weight of 268.29 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-[[methyl(2-methylsulfonylethyl)carbamoyl]amino]propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-[[methyl(2-methylsulfonylethyl)carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 80756409 |
| Molecular Formula | C8H16N2O6S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | (2R)-3-hydroxy-2-[[methyl(2-methylsulfonylethyl)carbamoyl]amino]propanoic acid |
| SMILES | CN(CCS(C)(=O)=O)C(=O)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C8H16N2O6S/c1-10(3-4-17(2,15)16)8(14)9-6(5-11)7(12)13/h6,11H,3-5H2,1-2H3,(H,9,14)(H,12,13)/t6-/m1/s1 |
| InChIKey | HBNLLKGUJGRBTQ-ZCFIWIBFSA-N |
| XLogP | -1.88 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |