C8H16N2O5 — CID 80757694
(2R)-3-hydroxy-2-[[2-hydroxypropyl(methyl)carbamoyl]amino]propanoic acid (PubChem CID 80757694) has the molecular formula C8H16N2O5 and a molecular weight of 220.22 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-[[2-hydroxypropyl(methyl)carbamoyl]amino]propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-[[2-hydroxypropyl(methyl)carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 80757694 |
| Molecular Formula | C8H16N2O5 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (2R)-3-hydroxy-2-[[2-hydroxypropyl(methyl)carbamoyl]amino]propanoic acid |
| SMILES | CC(O)CN(C)C(=O)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C8H16N2O5/c1-5(12)3-10(2)8(15)9-6(4-11)7(13)14/h5-6,11-12H,3-4H2,1-2H3,(H,9,15)(H,13,14)/t5?,6-/m1/s1 |
| InChIKey | KUKASLZXQXSFDY-PRJDIBJQSA-N |
| XLogP | -1.55 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |