C15H29NO5 — CID 123257330
2-[2-[(2-methoxyacetyl)amino]ethoxy]ethyl 2,2,3,3-tetramethylbutanoate (PubChem CID 123257330) has the molecular formula C15H29NO5 and a molecular weight of 303.40 g/mol. Its IUPAC name is 2-[2-[(2-methoxyacetyl)amino]ethoxy]ethyl 2,2,3,3-tetramethylbutanoate.
| Compound Name | 2-[2-[(2-methoxyacetyl)amino]ethoxy]ethyl 2,2,3,3-tetramethylbutanoate |
|---|---|
| PubChem CID | 123257330 |
| Molecular Formula | C15H29NO5 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 2-[2-[(2-methoxyacetyl)amino]ethoxy]ethyl 2,2,3,3-tetramethylbutanoate |
| SMILES | COCC(=O)NCCOCCOC(=O)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H29NO5/c1-14(2,3)15(4,5)13(18)21-10-9-20-8-7-16-12(17)11-19-6/h7-11H2,1-6H3,(H,16,17) |
| InChIKey | RUCJKUATFKITGB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|