About S-(2-ethoxyethyl) 2-hydroxyethanethioate
S-(2-ethoxyethyl) 2-hydroxyethanethioate (PubChem CID 57098905) has the molecular formula C6H12O3S
and a molecular weight of 164.23 g/mol. Its IUPAC name is S-(2-ethoxyethyl) 2-hydroxyethanethioate.
Molecular Properties
| Compound Name | S-(2-ethoxyethyl) 2-hydroxyethanethioate |
| PubChem CID | 57098905 |
| Molecular Formula | C6H12O3S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | S-(2-ethoxyethyl) 2-hydroxyethanethioate |
| SMILES | CCOCCSC(=O)CO |
| InChI | InChI=1S/C6H12O3S/c1-2-9-3-4-10-6(8)5-7/h7H,2-5H2,1H3 |
| InChIKey | FQZDMFWAHAEOIP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-ethoxyethyl) 2-hydroxyethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-ethoxyethyl) 2-hydroxyethanethioate?
The IUPAC name of S-(2-ethoxyethyl) 2-hydroxyethanethioate (CID 57098905) is S-(2-ethoxyethyl) 2-hydroxyethanethioate.
What is the SMILES notation for S-(2-ethoxyethyl) 2-hydroxyethanethioate?
The canonical SMILES for S-(2-ethoxyethyl) 2-hydroxyethanethioate is CCOCCSC(=O)CO.
What is the InChIKey of S-(2-ethoxyethyl) 2-hydroxyethanethioate?
The InChIKey is FQZDMFWAHAEOIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3S/c1-2-9-3-4-10-6(8)5-7/h7H,2-5H2,1H3.
What are the key properties of S-(2-ethoxyethyl) 2-hydroxyethanethioate?
S-(2-ethoxyethyl) 2-hydroxyethanethioate has a molecular weight of 164.23 g/mol, XLogP of 0.28, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-ethoxyethyl) 2-hydroxyethanethioate is sourced from PubChem (CID 57098905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).