About S-(5-oxohept-6-enyl) ethanethioate
S-(5-oxohept-6-enyl) ethanethioate (PubChem CID 139751819) has the molecular formula C9H14O2S
and a molecular weight of 186.28 g/mol. Its IUPAC name is S-(5-oxohept-6-enyl) ethanethioate.
Molecular Properties
| Compound Name | S-(5-oxohept-6-enyl) ethanethioate |
| PubChem CID | 139751819 |
| Molecular Formula | C9H14O2S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | S-(5-oxohept-6-enyl) ethanethioate |
| SMILES | C=CC(=O)CCCCSC(C)=O |
| InChI | InChI=1S/C9H14O2S/c1-3-9(11)6-4-5-7-12-8(2)10/h3H,1,4-7H2,2H3 |
| InChIKey | HFVQMCWFELQKKX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(5-oxohept-6-enyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(5-oxohept-6-enyl) ethanethioate?
The IUPAC name of S-(5-oxohept-6-enyl) ethanethioate (CID 139751819) is S-(5-oxohept-6-enyl) ethanethioate.
What is the SMILES notation for S-(5-oxohept-6-enyl) ethanethioate?
The canonical SMILES for S-(5-oxohept-6-enyl) ethanethioate is C=CC(=O)CCCCSC(C)=O.
What is the InChIKey of S-(5-oxohept-6-enyl) ethanethioate?
The InChIKey is HFVQMCWFELQKKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2S/c1-3-9(11)6-4-5-7-12-8(2)10/h3H,1,4-7H2,2H3.
What are the key properties of S-(5-oxohept-6-enyl) ethanethioate?
S-(5-oxohept-6-enyl) ethanethioate has a molecular weight of 186.28 g/mol, XLogP of 2.19, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(5-oxohept-6-enyl) ethanethioate is sourced from PubChem (CID 139751819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).