C27H52O2S6 — CID 167568027
1,15-bis(sulfanyl)-4,4,12,12-tetrakis(3-sulfanylpropyl)pentadecane-5,11-dione (PubChem CID 167568027) has the molecular formula C27H52O2S6 and a molecular weight of 601.11 g/mol. Its IUPAC name is 1,15-bis(sulfanyl)-4,4,12,12-tetrakis(3-sulfanylpropyl)pentadecane-5,11-dione.
| Compound Name | 1,15-bis(sulfanyl)-4,4,12,12-tetrakis(3-sulfanylpropyl)pentadecane-5,11-dione |
|---|---|
| PubChem CID | 167568027 |
| Molecular Formula | C27H52O2S6 |
| Molecular Weight | 601.11 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | 1,15-bis(sulfanyl)-4,4,12,12-tetrakis(3-sulfanylpropyl)pentadecane-5,11-dione |
| SMILES | O=C(CCCCCC(=O)C(CCCS)(CCCS)CCCS)C(CCCS)(CCCS)CCCS |
| InChI | InChI=1S/C27H52O2S6/c28-24(26(12-4-18-30,13-5-19-31)14-6-20-32)10-2-1-3-11-25(29)27(15-7-21-33,16-8-22-34)17-9-23-35/h30-35H,1-23H2 |
| InChIKey | GUNHFFYAOCQWKV-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.11 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|