About lithium 11-sulfanylundecanoate
lithium 11-sulfanylundecanoate (PubChem CID 175840198) has the molecular formula C11H21LiO2S
and a molecular weight of 224.29 g/mol. Its IUPAC name is lithium 11-sulfanylundecanoate.
Molecular Properties
| Compound Name | lithium 11-sulfanylundecanoate |
| PubChem CID | 175840198 |
| Molecular Formula | C11H21LiO2S |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | lithium 11-sulfanylundecanoate |
| SMILES | O=C([O-])CCCCCCCCCCS.[Li+] |
| InChI | InChI=1S/C11H22O2S.Li/c12-11(13)9-7-5-3-1-2-4-6-8-10-14;/h14H,1-10H2,(H,12,13);/q;+1/p-1 |
| InChIKey | KPJWARHHKASXBM-UHFFFAOYSA-M |
| XLogP | -0.82 |
| TPSA | 40.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze lithium 11-sulfanylundecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 11-sulfanylundecanoate?
The IUPAC name of lithium 11-sulfanylundecanoate (CID 175840198) is lithium 11-sulfanylundecanoate.
What is the SMILES notation for lithium 11-sulfanylundecanoate?
The canonical SMILES for lithium 11-sulfanylundecanoate is O=C([O-])CCCCCCCCCCS.[Li+].
What is the InChIKey of lithium 11-sulfanylundecanoate?
The InChIKey is KPJWARHHKASXBM-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H22O2S.Li/c12-11(13)9-7-5-3-1-2-4-6-8-10-14;/h14H,1-10H2,(H,12,13);/q;+1/p-1.
What are the key properties of lithium 11-sulfanylundecanoate?
lithium 11-sulfanylundecanoate has a molecular weight of 224.29 g/mol, XLogP of -0.82, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 11-sulfanylundecanoate is sourced from PubChem (CID 175840198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).