About lithium 19-sulfanylnonadecanoate
lithium 19-sulfanylnonadecanoate (PubChem CID 175840181) has the molecular formula C19H37LiO2S
and a molecular weight of 336.51 g/mol. Its IUPAC name is lithium 19-sulfanylnonadecanoate.
Molecular Properties
| Compound Name | lithium 19-sulfanylnonadecanoate |
| PubChem CID | 175840181 |
| Molecular Formula | C19H37LiO2S |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | lithium 19-sulfanylnonadecanoate |
| SMILES | O=C([O-])CCCCCCCCCCCCCCCCCCS.[Li+] |
| InChI | InChI=1S/C19H38O2S.Li/c20-19(21)17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-22;/h22H,1-18H2,(H,20,21);/q;+1/p-1 |
| InChIKey | QACZXDXLXQTUAQ-UHFFFAOYSA-M |
| XLogP | 2.30 |
| TPSA | 40.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze lithium 19-sulfanylnonadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 19-sulfanylnonadecanoate?
The IUPAC name of lithium 19-sulfanylnonadecanoate (CID 175840181) is lithium 19-sulfanylnonadecanoate.
What is the SMILES notation for lithium 19-sulfanylnonadecanoate?
The canonical SMILES for lithium 19-sulfanylnonadecanoate is O=C([O-])CCCCCCCCCCCCCCCCCCS.[Li+].
What is the InChIKey of lithium 19-sulfanylnonadecanoate?
The InChIKey is QACZXDXLXQTUAQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H38O2S.Li/c20-19(21)17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-22;/h22H,1-18H2,(H,20,21);/q;+1/p-1.
What are the key properties of lithium 19-sulfanylnonadecanoate?
lithium 19-sulfanylnonadecanoate has a molecular weight of 336.51 g/mol, XLogP of 2.30, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 19-sulfanylnonadecanoate is sourced from PubChem (CID 175840181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).