About sodium 9-sulfanylnonanoate
sodium 9-sulfanylnonanoate (PubChem CID 175840191) has the molecular formula C9H17NaO2S
and a molecular weight of 212.29 g/mol. Its IUPAC name is sodium 9-sulfanylnonanoate.
Molecular Properties
| Compound Name | sodium 9-sulfanylnonanoate |
| PubChem CID | 175840191 |
| Molecular Formula | C9H17NaO2S |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | sodium 9-sulfanylnonanoate |
| SMILES | O=C([O-])CCCCCCCCS.[Na+] |
| InChI | InChI=1S/C9H18O2S.Na/c10-9(11)7-5-3-1-2-4-6-8-12;/h12H,1-8H2,(H,10,11);/q;+1/p-1 |
| InChIKey | ZZGLKJMPSIWAHR-UHFFFAOYSA-M |
| XLogP | -1.60 |
| TPSA | 40.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 9-sulfanylnonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 9-sulfanylnonanoate?
The IUPAC name of sodium 9-sulfanylnonanoate (CID 175840191) is sodium 9-sulfanylnonanoate.
What is the SMILES notation for sodium 9-sulfanylnonanoate?
The canonical SMILES for sodium 9-sulfanylnonanoate is O=C([O-])CCCCCCCCS.[Na+].
What is the InChIKey of sodium 9-sulfanylnonanoate?
The InChIKey is ZZGLKJMPSIWAHR-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H18O2S.Na/c10-9(11)7-5-3-1-2-4-6-8-12;/h12H,1-8H2,(H,10,11);/q;+1/p-1.
What are the key properties of sodium 9-sulfanylnonanoate?
sodium 9-sulfanylnonanoate has a molecular weight of 212.29 g/mol, XLogP of -1.60, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 9-sulfanylnonanoate is sourced from PubChem (CID 175840191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).