About ethane;3-phenylpropanoate;yttrium
ethane;3-phenylpropanoate;yttrium (PubChem CID 160889858) has the molecular formula C11H14O2Y-2
and a molecular weight of 267.14 g/mol. Its IUPAC name is ethane;3-phenylpropanoate;yttrium.
Molecular Properties
| Compound Name | ethane;3-phenylpropanoate;yttrium |
| PubChem CID | 160889858 |
| Molecular Formula | C11H14O2Y-2 |
| Molecular Weight | 267.14 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | ethane;3-phenylpropanoate;yttrium |
| SMILES | CC.O=C([O-])[CH-]Cc1ccccc1.[Y] |
| InChI | InChI=1S/C9H9O2.C2H6.Y/c10-9(11)7-6-8-4-2-1-3-5-8;1-2;/h1-5,7H,6H2,(H,10,11);1-2H3;/q-1;;/p-1 |
| InChIKey | FEGWFFVLDZSXET-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.14 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-phenylpropanoate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-phenylpropanoate;yttrium?
The IUPAC name of ethane;3-phenylpropanoate;yttrium (CID 160889858) is ethane;3-phenylpropanoate;yttrium.
What is the SMILES notation for ethane;3-phenylpropanoate;yttrium?
The canonical SMILES for ethane;3-phenylpropanoate;yttrium is CC.O=C([O-])[CH-]Cc1ccccc1.[Y].
What is the InChIKey of ethane;3-phenylpropanoate;yttrium?
The InChIKey is FEGWFFVLDZSXET-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H9O2.C2H6.Y/c10-9(11)7-6-8-4-2-1-3-5-8;1-2;/h1-5,7H,6H2,(H,10,11);1-2H3;/q-1;;/p-1.
What are the key properties of ethane;3-phenylpropanoate;yttrium?
ethane;3-phenylpropanoate;yttrium has a molecular weight of 267.14 g/mol, XLogP of 1.21, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-phenylpropanoate;yttrium is sourced from PubChem (CID 160889858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).