About zinc propylbenzene
zinc propylbenzene (PubChem CID 562413) has the molecular formula C18H22Zn
and a molecular weight of 303.76 g/mol. Its IUPAC name is zinc propylbenzene.
Molecular Properties
| Compound Name | zinc propylbenzene |
| PubChem CID | 562413 |
| Molecular Formula | C18H22Zn |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | zinc propylbenzene |
| SMILES | C[CH-]Cc1ccccc1.C[CH-]Cc1ccccc1.[Zn+2] |
| InChI | InChI=1S/2C9H11.Zn/c2*1-2-6-9-7-4-3-5-8-9;/h2*2-5,7-8H,6H2,1H3;/q2*-1;+2 |
| InChIKey | JADNSUUPWGZXBU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc propylbenzene?
The IUPAC name of zinc propylbenzene (CID 562413) is zinc propylbenzene.
What is the SMILES notation for zinc propylbenzene?
The canonical SMILES for zinc propylbenzene is C[CH-]Cc1ccccc1.C[CH-]Cc1ccccc1.[Zn+2].
What is the InChIKey of zinc propylbenzene?
The InChIKey is JADNSUUPWGZXBU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H11.Zn/c2*1-2-6-9-7-4-3-5-8-9;/h2*2-5,7-8H,6H2,1H3;/q2*-1;+2.
What are the key properties of zinc propylbenzene?
zinc propylbenzene has a molecular weight of 303.76 g/mol, XLogP of 4.90, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc propylbenzene is sourced from PubChem (CID 562413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).