About 4-thiophen-3-ylbutoxysulfonylmethyl 4-thiophen-3-ylbutanoate
4-thiophen-3-ylbutoxysulfonylmethyl 4-thiophen-3-ylbutanoate (PubChem CID 88649309) has the molecular formula C17H22O5S3
and a molecular weight of 402.56 g/mol. Its IUPAC name is 4-thiophen-3-ylbutoxysulfonylmethyl 4-thiophen-3-ylbutanoate.
Molecular Properties
| Compound Name | 4-thiophen-3-ylbutoxysulfonylmethyl 4-thiophen-3-ylbutanoate |
| PubChem CID | 88649309 |
| Molecular Formula | C17H22O5S3 |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 4-thiophen-3-ylbutoxysulfonylmethyl 4-thiophen-3-ylbutanoate |
| SMILES | O=C(CCCc1ccsc1)OCS(=O)(=O)OCCCCc1ccsc1 |
| InChI | InChI=1S/C17H22O5S3/c18-17(6-3-5-16-8-11-24-13-16)21-14-25(19,20)22-9-2-1-4-15-7-10-23-12-15/h7-8,10-13H,1-6,9,14H2 |
| InChIKey | IOHHEIXNCKUKEH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 4-thiophen-3-ylbutoxysulfonylmethyl 4-thiophen-3-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thiophen-3-ylbutoxysulfonylmethyl 4-thiophen-3-ylbutanoate?
The IUPAC name of 4-thiophen-3-ylbutoxysulfonylmethyl 4-thiophen-3-ylbutanoate (CID 88649309) is 4-thiophen-3-ylbutoxysulfonylmethyl 4-thiophen-3-ylbutanoate.
What is the SMILES notation for 4-thiophen-3-ylbutoxysulfonylmethyl 4-thiophen-3-ylbutanoate?
The canonical SMILES for 4-thiophen-3-ylbutoxysulfonylmethyl 4-thiophen-3-ylbutanoate is O=C(CCCc1ccsc1)OCS(=O)(=O)OCCCCc1ccsc1.
What is the InChIKey of 4-thiophen-3-ylbutoxysulfonylmethyl 4-thiophen-3-ylbutanoate?
The InChIKey is IOHHEIXNCKUKEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O5S3/c18-17(6-3-5-16-8-11-24-13-16)21-14-25(19,20)22-9-2-1-4-15-7-10-23-12-15/h7-8,10-13H,1-6,9,14H2.
What are the key properties of 4-thiophen-3-ylbutoxysulfonylmethyl 4-thiophen-3-ylbutanoate?
4-thiophen-3-ylbutoxysulfonylmethyl 4-thiophen-3-ylbutanoate has a molecular weight of 402.56 g/mol, XLogP of 4.00, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thiophen-3-ylbutoxysulfonylmethyl 4-thiophen-3-ylbutanoate is sourced from PubChem (CID 88649309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).