C13H22N2O4S2 — CID 30126219
N,N-diethyl-4-[2-(methanesulfonamido)ethyl]benzenesulfonamide (PubChem CID 30126219) has the molecular formula C13H22N2O4S2 and a molecular weight of 334.46 g/mol. Its IUPAC name is N,N-diethyl-4-[2-(methanesulfonamido)ethyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[2-(methanesulfonamido)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 30126219 |
| Molecular Formula | C13H22N2O4S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N,N-diethyl-4-[2-(methanesulfonamido)ethyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCNS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H22N2O4S2/c1-4-15(5-2)21(18,19)13-8-6-12(7-9-13)10-11-14-20(3,16)17/h6-9,14H,4-5,10-11H2,1-3H3 |
| InChIKey | ATHPPXPLUCQDSJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |