C21H29N3O6S2 — CID 30126262
ethyl N-[4-[2-[4-(diethylsulfamoyl)phenyl]ethylsulfamoyl]phenyl]carbamate (PubChem CID 30126262) has the molecular formula C21H29N3O6S2 and a molecular weight of 483.61 g/mol. Its IUPAC name is ethyl N-[4-[2-[4-(diethylsulfamoyl)phenyl]ethylsulfamoyl]phenyl]carbamate.
| Compound Name | ethyl N-[4-[2-[4-(diethylsulfamoyl)phenyl]ethylsulfamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 30126262 |
| Molecular Formula | C21H29N3O6S2 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | ethyl N-[4-[2-[4-(diethylsulfamoyl)phenyl]ethylsulfamoyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(S(=O)(=O)NCCc2ccc(S(=O)(=O)N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C21H29N3O6S2/c1-4-24(5-2)32(28,29)20-11-7-17(8-12-20)15-16-22-31(26,27)19-13-9-18(10-14-19)23-21(25)30-6-3/h7-14,22H,4-6,15-16H2,1-3H3,(H,23,25) |
| InChIKey | SFZGPNZOBRJCKW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |