C18H22FN3O5S — CID 34446965
N-[2-[[5-(diethylsulfamoyl)-2-fluorobenzoyl]amino]ethyl]furan-2-carboxamide (PubChem CID 34446965) has the molecular formula C18H22FN3O5S and a molecular weight of 411.46 g/mol. Its IUPAC name is N-[2-[[5-(diethylsulfamoyl)-2-fluorobenzoyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[5-(diethylsulfamoyl)-2-fluorobenzoyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 34446965 |
| Molecular Formula | C18H22FN3O5S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N-[2-[[5-(diethylsulfamoyl)-2-fluorobenzoyl]amino]ethyl]furan-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)NCCNC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C18H22FN3O5S/c1-3-22(4-2)28(25,26)13-7-8-15(19)14(12-13)17(23)20-9-10-21-18(24)16-6-5-11-27-16/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | FHDNPDYKOALCCY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|