C18H20FNO4S — CID 33006391
N-(2-fluoro-5-methylsulfonylphenyl)-2-(4-propan-2-ylphenoxy)acetamide (PubChem CID 33006391) has the molecular formula C18H20FNO4S and a molecular weight of 365.43 g/mol. Its IUPAC name is N-(2-fluoro-5-methylsulfonylphenyl)-2-(4-propan-2-ylphenoxy)acetamide.
| Compound Name | N-(2-fluoro-5-methylsulfonylphenyl)-2-(4-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 33006391 |
| Molecular Formula | C18H20FNO4S |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | N-(2-fluoro-5-methylsulfonylphenyl)-2-(4-propan-2-ylphenoxy)acetamide |
| SMILES | CC(C)c1ccc(OCC(=O)Nc2cc(S(C)(=O)=O)ccc2F)cc1 |
| InChI | InChI=1S/C18H20FNO4S/c1-12(2)13-4-6-14(7-5-13)24-11-18(21)20-17-10-15(25(3,22)23)8-9-16(17)19/h4-10,12H,11H2,1-3H3,(H,20,21) |
| InChIKey | CVRMAKRIOIIOPK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |