C13H14FNO2S2 — CID 47109825
N-[1-(4-fluorophenyl)ethyl]-5-methylthiophene-2-sulfonamide (PubChem CID 47109825) has the molecular formula C13H14FNO2S2 and a molecular weight of 299.39 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethyl]-5-methylthiophene-2-sulfonamide.
| Compound Name | N-[1-(4-fluorophenyl)ethyl]-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 47109825 |
| Molecular Formula | C13H14FNO2S2 |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethyl]-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C13H14FNO2S2/c1-9-3-8-13(18-9)19(16,17)15-10(2)11-4-6-12(14)7-5-11/h3-8,10,15H,1-2H3 |
| InChIKey | NUQLMOTWYPSVHB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |