C11H13N3O5S2 — CID 80730776
5-amino-N-[1-(5-methylfuran-2-yl)ethyl]-4-nitrothiophene-2-sulfonamide (PubChem CID 80730776) has the molecular formula C11H13N3O5S2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 5-amino-N-[1-(5-methylfuran-2-yl)ethyl]-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-amino-N-[1-(5-methylfuran-2-yl)ethyl]-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80730776 |
| Molecular Formula | C11H13N3O5S2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 5-amino-N-[1-(5-methylfuran-2-yl)ethyl]-4-nitrothiophene-2-sulfonamide |
| SMILES | Cc1ccc(C(C)NS(=O)(=O)c2cc([N+](=O)[O-])c(N)s2)o1 |
| InChI | InChI=1S/C11H13N3O5S2/c1-6-3-4-9(19-6)7(2)13-21(17,18)10-5-8(14(15)16)11(12)20-10/h3-5,7,13H,12H2,1-2H3 |
| InChIKey | HKOIZSCDCAQIIF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 128.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|