C9H10N4O5S2 — CID 106376706
5-amino-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-4-nitrothiophene-2-sulfonamide (PubChem CID 106376706) has the molecular formula C9H10N4O5S2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 5-amino-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-amino-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106376706 |
| Molecular Formula | C9H10N4O5S2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 5-amino-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-4-nitrothiophene-2-sulfonamide |
| SMILES | Cc1cnc(CNS(=O)(=O)c2cc([N+](=O)[O-])c(N)s2)o1 |
| InChI | InChI=1S/C9H10N4O5S2/c1-5-3-11-7(18-5)4-12-20(16,17)8-2-6(13(14)15)9(10)19-8/h2-3,12H,4,10H2,1H3 |
| InChIKey | PFJXAGULJJGPBD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|