C12H18ClNO2S — CID 112604497
N-[1-(5-chlorothiophen-2-yl)ethyl]-2-[(2-methylpropan-2-yl)oxy]acetamide (PubChem CID 112604497) has the molecular formula C12H18ClNO2S and a molecular weight of 275.80 g/mol. Its IUPAC name is N-[1-(5-chlorothiophen-2-yl)ethyl]-2-[(2-methylpropan-2-yl)oxy]acetamide.
| Compound Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-2-[(2-methylpropan-2-yl)oxy]acetamide |
|---|---|
| PubChem CID | 112604497 |
| Molecular Formula | C12H18ClNO2S |
| Molecular Weight | 275.80 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-2-[(2-methylpropan-2-yl)oxy]acetamide |
| SMILES | CC(NC(=O)COC(C)(C)C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H18ClNO2S/c1-8(9-5-6-10(13)17-9)14-11(15)7-16-12(2,3)4/h5-6,8H,7H2,1-4H3,(H,14,15) |
| InChIKey | ZCFBYHSTUTUXTG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.80 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |