C13H22ClNO2S — CID 54954410
1-[1-(5-chlorothiophen-2-yl)ethylamino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol (PubChem CID 54954410) has the molecular formula C13H22ClNO2S and a molecular weight of 291.84 g/mol. Its IUPAC name is 1-[1-(5-chlorothiophen-2-yl)ethylamino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol.
| Compound Name | 1-[1-(5-chlorothiophen-2-yl)ethylamino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol |
|---|---|
| PubChem CID | 54954410 |
| Molecular Formula | C13H22ClNO2S |
| Molecular Weight | 291.84 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-[1-(5-chlorothiophen-2-yl)ethylamino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol |
| SMILES | CC(NCC(O)COC(C)(C)C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H22ClNO2S/c1-9(11-5-6-12(14)18-11)15-7-10(16)8-17-13(2,3)4/h5-6,9-10,15-16H,7-8H2,1-4H3 |
| InChIKey | OXMRENNTCWSSPS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.84 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |