C15H24ClNO2S — CID 61469543
1-[1-(5-chlorothiophen-2-yl)ethylamino]-3-cyclohexyloxypropan-2-ol (PubChem CID 61469543) has the molecular formula C15H24ClNO2S and a molecular weight of 317.88 g/mol. Its IUPAC name is 1-[1-(5-chlorothiophen-2-yl)ethylamino]-3-cyclohexyloxypropan-2-ol.
| Compound Name | 1-[1-(5-chlorothiophen-2-yl)ethylamino]-3-cyclohexyloxypropan-2-ol |
|---|---|
| PubChem CID | 61469543 |
| Molecular Formula | C15H24ClNO2S |
| Molecular Weight | 317.88 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-[1-(5-chlorothiophen-2-yl)ethylamino]-3-cyclohexyloxypropan-2-ol |
| SMILES | CC(NCC(O)COC1CCCCC1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H24ClNO2S/c1-11(14-7-8-15(16)20-14)17-9-12(18)10-19-13-5-3-2-4-6-13/h7-8,11-13,17-18H,2-6,9-10H2,1H3 |
| InChIKey | UAMDXPSUULAJLH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.88 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |