C17H29N3O2 — CID 103917430
tert-butyl N-[2-[1-(2,4,6-trimethyl-3-pyridinyl)ethylamino]ethyl]carbamate (PubChem CID 103917430) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(2,4,6-trimethyl-3-pyridinyl)ethylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(2,4,6-trimethyl-3-pyridinyl)ethylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 103917430 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | tert-butyl N-[2-[1-(2,4,6-trimethyl-3-pyridinyl)ethylamino]ethyl]carbamate |
| SMILES | Cc1cc(C)c(C(C)NCCNC(=O)OC(C)(C)C)c(C)n1 |
| InChI | InChI=1S/C17H29N3O2/c1-11-10-12(2)20-14(4)15(11)13(3)18-8-9-19-16(21)22-17(5,6)7/h10,13,18H,8-9H2,1-7H3,(H,19,21) |
| InChIKey | VTHSPXGAQWWLBR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|