C19H31F2IN4O2 — CID 111711874
tert-butyl N-[3-[[N-[2-(3,4-difluorophenyl)propyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111711874) has the molecular formula C19H31F2IN4O2 and a molecular weight of 512.38 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-[2-(3,4-difluorophenyl)propyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N-[2-(3,4-difluorophenyl)propyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111711874 |
| Molecular Formula | C19H31F2IN4O2 |
| Molecular Weight | 512.38 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | tert-butyl N-[3-[[N-[2-(3,4-difluorophenyl)propyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCC(C)c1ccc(F)c(F)c1.I |
| InChI | InChI=1S/C19H30F2N4O2.HI/c1-13(14-7-8-15(20)16(21)11-14)12-25-17(22-5)23-9-6-10-24-18(26)27-19(2,3)4;/h7-8,11,13H,6,9-10,12H2,1-5H3,(H,24,26)(H2,22,23,25);1H |
| InChIKey | RHCPZUXQNLGZIT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|