C15H31IN4O4 — CID 111887494
methyl 2-methyl-3-[[N'-methyl-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]propanoate;hydroiodide (PubChem CID 111887494) has the molecular formula C15H31IN4O4 and a molecular weight of 458.34 g/mol. Its IUPAC name is methyl 2-methyl-3-[[N'-methyl-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]propanoate;hydroiodide.
| Compound Name | methyl 2-methyl-3-[[N'-methyl-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111887494 |
| Molecular Formula | C15H31IN4O4 |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | methyl 2-methyl-3-[[N'-methyl-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]propanoate;hydroiodide |
| SMILES | C/N=C(/NCCCNC(=O)OC(C)(C)C)NCC(C)C(=O)OC.I |
| InChI | InChI=1S/C15H30N4O4.HI/c1-11(12(20)22-6)10-19-13(16-5)17-8-7-9-18-14(21)23-15(2,3)4;/h11H,7-10H2,1-6H3,(H,18,21)(H2,16,17,19);1H |
| InChIKey | HRIHTGKUYOSTGF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|