C17H38IN5O2 — CID 111885828
tert-butyl N-[3-[[N-[3-(diethylamino)propyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111885828) has the molecular formula C17H38IN5O2 and a molecular weight of 471.43 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-[3-(diethylamino)propyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N-[3-(diethylamino)propyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111885828 |
| Molecular Formula | C17H38IN5O2 |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | tert-butyl N-[3-[[N-[3-(diethylamino)propyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | CCN(CC)CCCN/C(=N\C)NCCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C17H37N5O2.HI/c1-7-22(8-2)14-10-13-20-15(18-6)19-11-9-12-21-16(23)24-17(3,4)5;/h7-14H2,1-6H3,(H,21,23)(H2,18,19,20);1H |
| InChIKey | KXADMGXTNJLWRM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|