C16H33N5O3 — CID 111885811
tert-butyl N-[3-[[N'-methyl-N-[2-(2-methylpropanoylamino)ethyl]carbamimidoyl]amino]propyl]carbamate (PubChem CID 111885811) has the molecular formula C16H33N5O3 and a molecular weight of 343.47 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-methyl-N-[2-(2-methylpropanoylamino)ethyl]carbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N'-methyl-N-[2-(2-methylpropanoylamino)ethyl]carbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111885811 |
| Molecular Formula | C16H33N5O3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | tert-butyl N-[3-[[N'-methyl-N-[2-(2-methylpropanoylamino)ethyl]carbamimidoyl]amino]propyl]carbamate |
| SMILES | C/N=C(/NCCCNC(=O)OC(C)(C)C)NCCNC(=O)C(C)C |
| InChI | InChI=1S/C16H33N5O3/c1-12(2)13(22)18-10-11-20-14(17-6)19-8-7-9-21-15(23)24-16(3,4)5/h12H,7-11H2,1-6H3,(H,18,22)(H,21,23)(H2,17,19,20) |
| InChIKey | RRRHSQXMFQPGLR-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|