C18H40IN5O2 — CID 111884896
tert-butyl N-[2-[[N-[3-(dipropylamino)propyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111884896) has the molecular formula C18H40IN5O2 and a molecular weight of 485.46 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-[3-(dipropylamino)propyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N-[3-(dipropylamino)propyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111884896 |
| Molecular Formula | C18H40IN5O2 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | tert-butyl N-[2-[[N-[3-(dipropylamino)propyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | CCCN(CCC)CCCN/C(=N\C)NCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C18H39N5O2.HI/c1-7-13-23(14-8-2)15-9-10-20-16(19-6)21-11-12-22-17(24)25-18(3,4)5;/h7-15H2,1-6H3,(H,22,24)(H2,19,20,21);1H |
| InChIKey | BIIJUJRUOCRSKU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|