C15H33IN4 — CID 111869545
1-(cyclopropylmethyl)-3-[3-(dipropylamino)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111869545) has the molecular formula C15H33IN4 and a molecular weight of 396.36 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-[3-(dipropylamino)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(cyclopropylmethyl)-3-[3-(dipropylamino)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111869545 |
| Molecular Formula | C15H33IN4 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-[3-(dipropylamino)propyl]-2-methylguanidine;hydroiodide |
| SMILES | CCCN(CCC)CCCN/C(=N\C)NCC1CC1.I |
| InChI | InChI=1S/C15H32N4.HI/c1-4-10-19(11-5-2)12-6-9-17-15(16-3)18-13-14-7-8-14;/h14H,4-13H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | MTMBHKVARCGECA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|