C19H25F2N3O2 — CID 111501599
1-[2-(3,4-difluorophenyl)propyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine (PubChem CID 111501599) has the molecular formula C19H25F2N3O2 and a molecular weight of 365.42 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenyl)propyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine.
| Compound Name | 1-[2-(3,4-difluorophenyl)propyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111501599 |
| Molecular Formula | C19H25F2N3O2 |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 1-[2-(3,4-difluorophenyl)propyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCOCc1ccco1)NCC(C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H25F2N3O2/c1-14(15-6-7-17(20)18(21)11-15)12-24-19(22-2)23-8-4-9-25-13-16-5-3-10-26-16/h3,5-7,10-11,14H,4,8-9,12-13H2,1-2H3,(H2,22,23,24) |
| InChIKey | BZTGMDMUSRKTKU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|