C18H24FN3O2S — CID 111567475
1-[2-(4-fluorophenyl)sulfanylethyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine (PubChem CID 111567475) has the molecular formula C18H24FN3O2S and a molecular weight of 365.47 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)sulfanylethyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine.
| Compound Name | 1-[2-(4-fluorophenyl)sulfanylethyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111567475 |
| Molecular Formula | C18H24FN3O2S |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 1-[2-(4-fluorophenyl)sulfanylethyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCOCc1ccco1)NCCSc1ccc(F)cc1 |
| InChI | InChI=1S/C18H24FN3O2S/c1-20-18(21-9-3-11-23-14-16-4-2-12-24-16)22-10-13-25-17-7-5-15(19)6-8-17/h2,4-8,12H,3,9-11,13-14H2,1H3,(H2,20,21,22) |
| InChIKey | WLUPHKXOLQILIC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|