C20H29FIN3O3 — CID 111398428
1-[4-(4-fluorophenoxy)butyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111398428) has the molecular formula C20H29FIN3O3 and a molecular weight of 505.37 g/mol. Its IUPAC name is 1-[4-(4-fluorophenoxy)butyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[4-(4-fluorophenoxy)butyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111398428 |
| Molecular Formula | C20H29FIN3O3 |
| Molecular Weight | 505.37 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | 1-[4-(4-fluorophenoxy)butyl]-3-[3-(furan-2-ylmethoxy)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCCCOc1ccc(F)cc1)NCCCOCc1ccco1.I |
| InChI | InChI=1S/C20H28FN3O3.HI/c1-22-20(24-12-5-13-25-16-19-6-4-15-27-19)23-11-2-3-14-26-18-9-7-17(21)8-10-18;/h4,6-10,15H,2-3,5,11-14,16H2,1H3,(H2,22,23,24);1H |
| InChIKey | XTBUYUMMMITGHK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|