C13H17FO3 — CID 55245574
2-[(3-fluoro-4-methylphenyl)-hydroxymethyl]-3-methylbutanoic acid (PubChem CID 55245574) has the molecular formula C13H17FO3 and a molecular weight of 240.27 g/mol. Its IUPAC name is 2-[(3-fluoro-4-methylphenyl)-hydroxymethyl]-3-methylbutanoic acid.
| Compound Name | 2-[(3-fluoro-4-methylphenyl)-hydroxymethyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 55245574 |
| Molecular Formula | C13H17FO3 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-[(3-fluoro-4-methylphenyl)-hydroxymethyl]-3-methylbutanoic acid |
| SMILES | Cc1ccc(C(O)C(C(=O)O)C(C)C)cc1F |
| InChI | InChI=1S/C13H17FO3/c1-7(2)11(13(16)17)12(15)9-5-4-8(3)10(14)6-9/h4-7,11-12,15H,1-3H3,(H,16,17) |
| InChIKey | NREDGWQDNHWELY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |