C17H27NO4 — CID 174324695
2-acetamido-2-ethylbutanoic acid;1-methoxy-2,4-dimethylbenzene (PubChem CID 174324695) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-acetamido-2-ethylbutanoic acid;1-methoxy-2,4-dimethylbenzene.
| Compound Name | 2-acetamido-2-ethylbutanoic acid;1-methoxy-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 174324695 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2-acetamido-2-ethylbutanoic acid;1-methoxy-2,4-dimethylbenzene |
| SMILES | CCC(CC)(NC(C)=O)C(=O)O.COc1ccc(C)cc1C |
| InChI | InChI=1S/C9H12O.C8H15NO3/c1-7-4-5-9(10-3)8(2)6-7;1-4-8(5-2,7(11)12)9-6(3)10/h4-6H,1-3H3;4-5H2,1-3H3,(H,9,10)(H,11,12) |
| InChIKey | YQXNLKDTAGVVSE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |