About (4-amino-2-chloro-5-methylphenyl) sulfite;azane
(4-amino-2-chloro-5-methylphenyl) sulfite;azane (PubChem CID 175289666) has the molecular formula C7H10ClN2O3S-
and a molecular weight of 237.69 g/mol. Its IUPAC name is (4-amino-2-chloro-5-methylphenyl) sulfite;azane.
Molecular Properties
| Compound Name | (4-amino-2-chloro-5-methylphenyl) sulfite;azane |
| PubChem CID | 175289666 |
| Molecular Formula | C7H10ClN2O3S- |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | (4-amino-2-chloro-5-methylphenyl) sulfite;azane |
| SMILES | Cc1cc(OS(=O)[O-])c(Cl)cc1N.N |
| InChI | InChI=1S/C7H8ClNO3S.H3N/c1-4-2-7(12-13(10)11)5(8)3-6(4)9;/h2-3H,9H2,1H3,(H,10,11);1H3/p-1 |
| InChIKey | LMBBFQZIXIMCPP-UHFFFAOYSA-M |
| XLogP | 1.57 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-2-chloro-5-methylphenyl) sulfite;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-2-chloro-5-methylphenyl) sulfite;azane?
The IUPAC name of (4-amino-2-chloro-5-methylphenyl) sulfite;azane (CID 175289666) is (4-amino-2-chloro-5-methylphenyl) sulfite;azane.
What is the SMILES notation for (4-amino-2-chloro-5-methylphenyl) sulfite;azane?
The canonical SMILES for (4-amino-2-chloro-5-methylphenyl) sulfite;azane is Cc1cc(OS(=O)[O-])c(Cl)cc1N.N.
What is the InChIKey of (4-amino-2-chloro-5-methylphenyl) sulfite;azane?
The InChIKey is LMBBFQZIXIMCPP-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8ClNO3S.H3N/c1-4-2-7(12-13(10)11)5(8)3-6(4)9;/h2-3H,9H2,1H3,(H,10,11);1H3/p-1.
What are the key properties of (4-amino-2-chloro-5-methylphenyl) sulfite;azane?
(4-amino-2-chloro-5-methylphenyl) sulfite;azane has a molecular weight of 237.69 g/mol, XLogP of 1.57, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-2-chloro-5-methylphenyl) sulfite;azane is sourced from PubChem (CID 175289666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).