C16H19NOS — CID 81190175
3-[(2,5-dimethylphenyl)methylsulfinyl]-4-methylaniline (PubChem CID 81190175) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is 3-[(2,5-dimethylphenyl)methylsulfinyl]-4-methylaniline.
| Compound Name | 3-[(2,5-dimethylphenyl)methylsulfinyl]-4-methylaniline |
|---|---|
| PubChem CID | 81190175 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 3-[(2,5-dimethylphenyl)methylsulfinyl]-4-methylaniline |
| SMILES | Cc1ccc(C)c(CS(=O)c2cc(N)ccc2C)c1 |
| InChI | InChI=1S/C16H19NOS/c1-11-4-5-12(2)14(8-11)10-19(18)16-9-15(17)7-6-13(16)3/h4-9H,10,17H2,1-3H3 |
| InChIKey | PQPBHKPTXZKUBT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|