C9H5N3O5S — CID 71664043
[2-(3,5-dinitrophenyl)-2-oxoethyl] thiocyanate (PubChem CID 71664043) has the molecular formula C9H5N3O5S and a molecular weight of 267.22 g/mol. Its IUPAC name is [2-(3,5-dinitrophenyl)-2-oxoethyl] thiocyanate.
| Compound Name | [2-(3,5-dinitrophenyl)-2-oxoethyl] thiocyanate |
|---|---|
| PubChem CID | 71664043 |
| Molecular Formula | C9H5N3O5S |
| Molecular Weight | 267.22 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | [2-(3,5-dinitrophenyl)-2-oxoethyl] thiocyanate |
| SMILES | N#CSCC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H5N3O5S/c10-5-18-4-9(13)6-1-7(11(14)15)3-8(2-6)12(16)17/h1-3H,4H2 |
| InChIKey | MWYJQPSVGITWTQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 127.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|