About 4-nitrobenzoate;pyridin-1-ium-4-amine
4-nitrobenzoate;pyridin-1-ium-4-amine (PubChem CID 155288919) has the molecular formula C12H11N3O4
and a molecular weight of 261.24 g/mol. Its IUPAC name is 4-nitrobenzoate;pyridin-1-ium-4-amine.
Molecular Properties
| Compound Name | 4-nitrobenzoate;pyridin-1-ium-4-amine |
| PubChem CID | 155288919 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 4-nitrobenzoate;pyridin-1-ium-4-amine |
| SMILES | Nc1cc[nH+]cc1.O=C([O-])c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C7H5NO4.C5H6N2/c9-7(10)5-1-3-6(4-2-5)8(11)12;6-5-1-3-7-4-2-5/h1-4H,(H,9,10);1-4H,(H2,6,7) |
| InChIKey | YAXXWXPZBVNRRQ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 123.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitrobenzoate;pyridin-1-ium-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrobenzoate;pyridin-1-ium-4-amine?
The IUPAC name of 4-nitrobenzoate;pyridin-1-ium-4-amine (CID 155288919) is 4-nitrobenzoate;pyridin-1-ium-4-amine.
What is the SMILES notation for 4-nitrobenzoate;pyridin-1-ium-4-amine?
The canonical SMILES for 4-nitrobenzoate;pyridin-1-ium-4-amine is Nc1cc[nH+]cc1.O=C([O-])c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 4-nitrobenzoate;pyridin-1-ium-4-amine?
The InChIKey is YAXXWXPZBVNRRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO4.C5H6N2/c9-7(10)5-1-3-6(4-2-5)8(11)12;6-5-1-3-7-4-2-5/h1-4H,(H,9,10);1-4H,(H2,6,7).
What are the key properties of 4-nitrobenzoate;pyridin-1-ium-4-amine?
4-nitrobenzoate;pyridin-1-ium-4-amine has a molecular weight of 261.24 g/mol, XLogP of 0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrobenzoate;pyridin-1-ium-4-amine is sourced from PubChem (CID 155288919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).