C32H34N2O8 — CID 87139416
8-[C-butyl-N-(4-nitrophenoxy)carbonimidoyl]-1,9-bis(4-hydroxyphenyl)nonane-1,3,9-trione (PubChem CID 87139416) has the molecular formula C32H34N2O8 and a molecular weight of 574.63 g/mol. Its IUPAC name is 8-[C-butyl-N-(4-nitrophenoxy)carbonimidoyl]-1,9-bis(4-hydroxyphenyl)nonane-1,3,9-trione.
| Compound Name | 8-[C-butyl-N-(4-nitrophenoxy)carbonimidoyl]-1,9-bis(4-hydroxyphenyl)nonane-1,3,9-trione |
|---|---|
| PubChem CID | 87139416 |
| Molecular Formula | C32H34N2O8 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | 8-[C-butyl-N-(4-nitrophenoxy)carbonimidoyl]-1,9-bis(4-hydroxyphenyl)nonane-1,3,9-trione |
| SMILES | CCCCC(=NOc1ccc([N+](=O)[O-])cc1)C(CCCCC(=O)CC(=O)c1ccc(O)cc1)C(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C32H34N2O8/c1-2-3-8-30(33-42-28-19-13-24(14-20-28)34(40)41)29(32(39)23-11-17-26(36)18-12-23)7-5-4-6-27(37)21-31(38)22-9-15-25(35)16-10-22/h9-20,29,35-36H,2-8,21H2,1H3 |
| InChIKey | ACNHTYSKUKIUKO-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 156.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|