C20H22N2O4 — CID 89192896
4-[(3E)-4-[(4-nitrophenoxy)amino]octa-1,3-dien-2-yl]phenol (PubChem CID 89192896) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 4-[(3E)-4-[(4-nitrophenoxy)amino]octa-1,3-dien-2-yl]phenol.
| Compound Name | 4-[(3E)-4-[(4-nitrophenoxy)amino]octa-1,3-dien-2-yl]phenol |
|---|---|
| PubChem CID | 89192896 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 4-[(3E)-4-[(4-nitrophenoxy)amino]octa-1,3-dien-2-yl]phenol |
| SMILES | C=C(/C=C(\CCCC)NOc1ccc([N+](=O)[O-])cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H22N2O4/c1-3-4-5-17(14-15(2)16-6-10-19(23)11-7-16)21-26-20-12-8-18(9-13-20)22(24)25/h6-14,21,23H,2-5H2,1H3/b17-14+ |
| InChIKey | ZETNJAZOORDWEB-SAPNQHFASA-N |
| XLogP | 4.97 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|