C13H14Cl2N2O — CID 6300945
N-[(Z)-1-(2,4-dichlorophenyl)propylideneamino]cyclopropanecarboxamide (PubChem CID 6300945) has the molecular formula C13H14Cl2N2O and a molecular weight of 285.17 g/mol. Its IUPAC name is N-[(Z)-1-(2,4-dichlorophenyl)propylideneamino]cyclopropanecarboxamide.
| Compound Name | N-[(Z)-1-(2,4-dichlorophenyl)propylideneamino]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 6300945 |
| Molecular Formula | C13H14Cl2N2O |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | N-[(Z)-1-(2,4-dichlorophenyl)propylideneamino]cyclopropanecarboxamide |
| SMILES | CC/C(=N/NC(=O)C1CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl2N2O/c1-2-12(16-17-13(18)8-3-4-8)10-6-5-9(14)7-11(10)15/h5-8H,2-4H2,1H3,(H,17,18)/b16-12- |
| InChIKey | OEGYNBLOONIQKP-VBKFSLOCSA-N |
| XLogP | 3.63 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|