C21H18Cl2N2O — CID 4133962
N-[1-(2,4-dichlorophenyl)propylideneamino]-2-naphthalen-1-ylacetamide (PubChem CID 4133962) has the molecular formula C21H18Cl2N2O and a molecular weight of 385.29 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)propylideneamino]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)propylideneamino]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 4133962 |
| Molecular Formula | C21H18Cl2N2O |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)propylideneamino]-2-naphthalen-1-ylacetamide |
| SMILES | CCC(=NNC(=O)Cc1cccc2ccccc12)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H18Cl2N2O/c1-2-20(18-11-10-16(22)13-19(18)23)24-25-21(26)12-15-8-5-7-14-6-3-4-9-17(14)15/h3-11,13H,2,12H2,1H3,(H,25,26) |
| InChIKey | QZYWGLYVQNSAEJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|