C10H10Cl2N4O3 — CID 3799613
N'-[[1-amino-2-(2,4-dichlorophenoxy)ethylidene]amino]oxamide (PubChem CID 3799613) has the molecular formula C10H10Cl2N4O3 and a molecular weight of 305.12 g/mol. Its IUPAC name is N'-[[1-amino-2-(2,4-dichlorophenoxy)ethylidene]amino]oxamide.
| Compound Name | N'-[[1-amino-2-(2,4-dichlorophenoxy)ethylidene]amino]oxamide |
|---|---|
| PubChem CID | 3799613 |
| Molecular Formula | C10H10Cl2N4O3 |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | N'-[[1-amino-2-(2,4-dichlorophenoxy)ethylidene]amino]oxamide |
| SMILES | NC(=O)C(=O)NN=C(N)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H10Cl2N4O3/c11-5-1-2-7(6(12)3-5)19-4-8(13)15-16-10(18)9(14)17/h1-3H,4H2,(H2,13,15)(H2,14,17)(H,16,18) |
| InChIKey | AGEBHQBZILLVMB-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|