C16H17N3O2S — CID 102449319
ethyl N-[(4-phenylanilino)carbamothioyl]carbamate (PubChem CID 102449319) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is ethyl N-[(4-phenylanilino)carbamothioyl]carbamate.
| Compound Name | ethyl N-[(4-phenylanilino)carbamothioyl]carbamate |
|---|---|
| PubChem CID | 102449319 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | ethyl N-[(4-phenylanilino)carbamothioyl]carbamate |
| SMILES | CCOC(=O)NC(=S)NNc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H17N3O2S/c1-2-21-16(20)17-15(22)19-18-14-10-8-13(9-11-14)12-6-4-3-5-7-12/h3-11,18H,2H2,1H3,(H2,17,19,20,22) |
| InChIKey | JGBAJQLHEISBQB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|