C11H15N3O3 — CID 136921362
methyl N-[N-(4-aminophenyl)-C-ethoxycarbonimidoyl]carbamate (PubChem CID 136921362) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is methyl N-[N-(4-aminophenyl)-C-ethoxycarbonimidoyl]carbamate.
| Compound Name | methyl N-[N-(4-aminophenyl)-C-ethoxycarbonimidoyl]carbamate |
|---|---|
| PubChem CID | 136921362 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | methyl N-[N-(4-aminophenyl)-C-ethoxycarbonimidoyl]carbamate |
| SMILES | CCO/C(=N\c1ccc(N)cc1)NC(=O)OC |
| InChI | InChI=1S/C11H15N3O3/c1-3-17-10(14-11(15)16-2)13-9-6-4-8(12)5-7-9/h4-7H,3,12H2,1-2H3,(H,13,14,15) |
| InChIKey | SYPITGCEKPFWEL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|