C15H21N5O8 — CID 67206076
ethyl carbamate;methyl N-[[2-(methoxycarbonylcarbamoylamino)phenyl]carbamoyl]carbamate (PubChem CID 67206076) has the molecular formula C15H21N5O8 and a molecular weight of 399.36 g/mol. Its IUPAC name is ethyl carbamate;methyl N-[[2-(methoxycarbonylcarbamoylamino)phenyl]carbamoyl]carbamate.
| Compound Name | ethyl carbamate;methyl N-[[2-(methoxycarbonylcarbamoylamino)phenyl]carbamoyl]carbamate |
|---|---|
| PubChem CID | 67206076 |
| Molecular Formula | C15H21N5O8 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | ethyl carbamate;methyl N-[[2-(methoxycarbonylcarbamoylamino)phenyl]carbamoyl]carbamate |
| SMILES | CCOC(N)=O.COC(=O)NC(=O)Nc1ccccc1NC(=O)NC(=O)OC |
| InChI | InChI=1S/C12H14N4O6.C3H7NO2/c1-21-11(19)15-9(17)13-7-5-3-4-6-8(7)14-10(18)16-12(20)22-2;1-2-6-3(4)5/h3-6H,1-2H3,(H2,13,15,17,19)(H2,14,16,18,20);2H2,1H3,(H2,4,5) |
| InChIKey | GFIMFKSARAIFGS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 187.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|