C14H20N4O6 — CID 161323635
1-carbamoyl-3-(phenylcarbamoyl)urea;diethyl carbonate (PubChem CID 161323635) has the molecular formula C14H20N4O6 and a molecular weight of 340.34 g/mol. Its IUPAC name is 1-carbamoyl-3-(phenylcarbamoyl)urea;diethyl carbonate.
| Compound Name | 1-carbamoyl-3-(phenylcarbamoyl)urea;diethyl carbonate |
|---|---|
| PubChem CID | 161323635 |
| Molecular Formula | C14H20N4O6 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-carbamoyl-3-(phenylcarbamoyl)urea;diethyl carbonate |
| SMILES | CCOC(=O)OCC.NC(=O)NC(=O)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C9H10N4O3.C5H10O3/c10-7(14)12-9(16)13-8(15)11-6-4-2-1-3-5-6;1-3-7-5(6)8-4-2/h1-5H,(H5,10,11,12,13,14,15,16);3-4H2,1-2H3 |
| InChIKey | VKMBRRLPLACJFX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |