About bis((Z)-2-benzoyl-3-ethoxy-3-hydroxy-N-phenylprop-2-enamide);copper
bis((Z)-2-benzoyl-3-ethoxy-3-hydroxy-N-phenylprop-2-enamide);copper (PubChem CID 11814456) has the molecular formula C36H34CuN2O8
and a molecular weight of 686.22 g/mol. Its IUPAC name is bis((Z)-2-benzoyl-3-ethoxy-3-hydroxy-N-phenylprop-2-enamide);copper.
Molecular Properties
| Compound Name | bis((Z)-2-benzoyl-3-ethoxy-3-hydroxy-N-phenylprop-2-enamide);copper |
| PubChem CID | 11814456 |
| Molecular Formula | C36H34CuN2O8 |
| Molecular Weight | 686.22 g/mol |
| Exact Mass | 685.16 |
| IUPAC Name | bis((Z)-2-benzoyl-3-ethoxy-3-hydroxy-N-phenylprop-2-enamide);copper |
| SMILES | CCO/C(O)=C(\C(=O)Nc1ccccc1)C(=O)c1ccccc1.CCO/C(O)=C(\C(=O)Nc1ccccc1)C(=O)c1ccccc1.[Cu] |
| InChI | InChI=1S/2C18H17NO4.Cu/c2*1-2-23-18(22)15(16(20)13-9-5-3-6-10-13)17(21)19-14-11-7-4-8-12-14;/h2*3-12,22H,2H2,1H3,(H,19,21);/b2*18-15-; |
| InChIKey | HEGGHNOJAQJXMM-SCQCTDIZSA-N |
| XLogP | 6.63 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 686.22 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze bis((Z)-2-benzoyl-3-ethoxy-3-hydroxy-N-phenylprop-2-enamide);copper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((Z)-2-benzoyl-3-ethoxy-3-hydroxy-N-phenylprop-2-enamide);copper?
The IUPAC name of bis((Z)-2-benzoyl-3-ethoxy-3-hydroxy-N-phenylprop-2-enamide);copper (CID 11814456) is bis((Z)-2-benzoyl-3-ethoxy-3-hydroxy-N-phenylprop-2-enamide);copper.
What is the SMILES notation for bis((Z)-2-benzoyl-3-ethoxy-3-hydroxy-N-phenylprop-2-enamide);copper?
The canonical SMILES for bis((Z)-2-benzoyl-3-ethoxy-3-hydroxy-N-phenylprop-2-enamide);copper is CCO/C(O)=C(\C(=O)Nc1ccccc1)C(=O)c1ccccc1.CCO/C(O)=C(\C(=O)Nc1ccccc1)C(=O)c1ccccc1.[Cu].
What is the InChIKey of bis((Z)-2-benzoyl-3-ethoxy-3-hydroxy-N-phenylprop-2-enamide);copper?
The InChIKey is HEGGHNOJAQJXMM-SCQCTDIZSA-N. The full InChI is InChI=1S/2C18H17NO4.Cu/c2*1-2-23-18(22)15(16(20)13-9-5-3-6-10-13)17(21)19-14-11-7-4-8-12-14;/h2*3-12,22H,2H2,1H3,(H,19,21);/b2*18-15-;.
What are the key properties of bis((Z)-2-benzoyl-3-ethoxy-3-hydroxy-N-phenylprop-2-enamide);copper?
bis((Z)-2-benzoyl-3-ethoxy-3-hydroxy-N-phenylprop-2-enamide);copper has a molecular weight of 686.22 g/mol, XLogP of 6.63, 12 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis((Z)-2-benzoyl-3-ethoxy-3-hydroxy-N-phenylprop-2-enamide);copper is sourced from PubChem (CID 11814456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).