C26H32O5 — CID 167054921
1-O-tert-butyl 4-O-propan-2-yl 3-methyl-2-[2-(4-phenylphenyl)acetyl]butanedioate (PubChem CID 167054921) has the molecular formula C26H32O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-propan-2-yl 3-methyl-2-[2-(4-phenylphenyl)acetyl]butanedioate.
| Compound Name | 1-O-tert-butyl 4-O-propan-2-yl 3-methyl-2-[2-(4-phenylphenyl)acetyl]butanedioate |
|---|---|
| PubChem CID | 167054921 |
| Molecular Formula | C26H32O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1-O-tert-butyl 4-O-propan-2-yl 3-methyl-2-[2-(4-phenylphenyl)acetyl]butanedioate |
| SMILES | CC(C)OC(=O)C(C)C(C(=O)Cc1ccc(-c2ccccc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H32O5/c1-17(2)30-24(28)18(3)23(25(29)31-26(4,5)6)22(27)16-19-12-14-21(15-13-19)20-10-8-7-9-11-20/h7-15,17-18,23H,16H2,1-6H3 |
| InChIKey | SVDOXGRRQROZND-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|