C34H39N3O6 — CID 10507564
benzyl N-[4-[(2S,4S)-2-(tert-butylcarbamoyl)-4-phenylmethoxypyrrolidin-1-yl]-3,4-dioxo-1-phenylbutan-2-yl]carbamate (PubChem CID 10507564) has the molecular formula C34H39N3O6 and a molecular weight of 585.70 g/mol. Its IUPAC name is benzyl N-[4-[(2S,4S)-2-(tert-butylcarbamoyl)-4-phenylmethoxypyrrolidin-1-yl]-3,4-dioxo-1-phenylbutan-2-yl]carbamate.
| Compound Name | benzyl N-[4-[(2S,4S)-2-(tert-butylcarbamoyl)-4-phenylmethoxypyrrolidin-1-yl]-3,4-dioxo-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10507564 |
| Molecular Formula | C34H39N3O6 |
| Molecular Weight | 585.70 g/mol |
| Exact Mass | 585.28 |
| IUPAC Name | benzyl N-[4-[(2S,4S)-2-(tert-butylcarbamoyl)-4-phenylmethoxypyrrolidin-1-yl]-3,4-dioxo-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)NC(=O)[C@@H]1C[C@H](OCc2ccccc2)CN1C(=O)C(=O)C(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H39N3O6/c1-34(2,3)36-31(39)29-20-27(42-22-25-15-9-5-10-16-25)21-37(29)32(40)30(38)28(19-24-13-7-4-8-14-24)35-33(41)43-23-26-17-11-6-12-18-26/h4-18,27-29H,19-23H2,1-3H3,(H,35,41)(H,36,39)/t27-,28?,29-/m0/s1 |
| InChIKey | JUZCPARXOSSUPV-QBGWAWDMSA-N |
| XLogP | 4.19 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.70 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|